N-benzyl-4-chloro-benzamide structure
|
Common Name | N-benzyl-4-chloro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 7461-34-9 | Molecular Weight | 245.70400 | |
| Density | 1.213g/cm3 | Boiling Point | 431.7ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | N-benzyl-4-chlorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 431.7ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.70400 |
| Flash Point | 214.9ºC |
| Exact Mass | 245.06100 |
| PSA | 29.10000 |
| LogP | 3.66090 |
| Index of Refraction | 1.6 |
| InChIKey | LSMWDKIFKGLNSW-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyl-4-chloro-benzamide |
| N-benzyl-p-chlorobenzamide |
| 4-Chlor-benzoesaeure-benzylamid |
| 4-chloro-benzoic acid benzylamide |