Acid Yellow 9 monosodium salt structure
|
Common Name | Acid Yellow 9 monosodium salt | ||
|---|---|---|---|---|
| CAS Number | 74543-21-8 | Molecular Weight | 379.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N3NaO6S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Acid Yellow 9 monosodium saltAcid Yellow 9 monosodium salt is an azo dye, degraded by Pseudomonas fluorescens as sole source of carbon, nitrogen and energy for the bacterium[1]. |
| Name | sodium hydrogen 4-aminoazobenzene-3,4'-disulphonate |
|---|
| Description | Acid Yellow 9 monosodium salt is an azo dye, degraded by Pseudomonas fluorescens as sole source of carbon, nitrogen and energy for the bacterium[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H10N3NaO6S2 |
|---|---|
| Molecular Weight | 379.34 |
| Exact Mass | 378.99100 |
| PSA | 179.07000 |
| LogP | 4.57780 |
| InChIKey | YXKNHTSZQIOQDP-UHFFFAOYSA-M |
| SMILES | Nc1ccc(N=Nc2ccc(S(=O)(=O)[O-])cc2)cc1S(=O)(=O)O.[Na+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2927000090 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |