[3-(3-methoxyphenyl)-2-oxo-chromen-7-yl] acetate structure
|
Common Name | [3-(3-methoxyphenyl)-2-oxo-chromen-7-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 7401-76-5 | Molecular Weight | 310.30100 | |
| Density | 1.288g/cm3 | Boiling Point | 504.4ºC at 760 mmHg | |
| Molecular Formula | C18H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9ºC | |
| Name | [3-(3-methoxyphenyl)-2-oxochromen-7-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 504.4ºC at 760 mmHg |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.30100 |
| Flash Point | 224.9ºC |
| Exact Mass | 310.08400 |
| PSA | 65.74000 |
| LogP | 3.39390 |
| Index of Refraction | 1.598 |
| InChIKey | YDQUSRUQFABOBQ-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cc3ccc(OC(C)=O)cc3oc2=O)c1 |
|
~%
[3-(3-methoxyph... CAS#:7401-76-5 |
| Literature: Walker Journal of the American Chemical Society, 1958 , vol. 80, p. 645,649 |
|
~%
[3-(3-methoxyph... CAS#:7401-76-5 |
| Literature: Kirkiacharian; Lormier; Resche-Rigon; Bouchoux; Cerede Annales Pharmaceutiques Francaises, 2003 , vol. 61, # 1 p. 51 - 56 |
| f3385-6205 |