[3-(3,4-dimethoxyphenyl)-2-oxo-chromen-7-yl] acetate structure
|
Common Name | [3-(3,4-dimethoxyphenyl)-2-oxo-chromen-7-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 6296-57-7 | Molecular Weight | 340.32700 | |
| Density | 1.284g/cm3 | Boiling Point | 518.9ºC at 760 mmHg | |
| Molecular Formula | C19H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.8ºC | |
| Name | [3-(3,4-dimethoxyphenyl)-2-oxochromen-7-yl] acetate |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 518.9ºC at 760 mmHg |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.32700 |
| Flash Point | 229.8ºC |
| Exact Mass | 340.09500 |
| PSA | 74.97000 |
| LogP | 3.40250 |
| Index of Refraction | 1.586 |
| InChIKey | VVUKIEHKMGJUKW-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc3ccc(OC(C)=O)cc3oc2=O)cc1OC |
|
~68%
[3-(3,4-dimetho... CAS#:6296-57-7 |
| Literature: Garazd; Ogorodniichuk; Khilya Chemistry of Natural Compounds, 2009 , vol. 45, # 2 p. 158 - 163 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |