7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one structure
|
Common Name | 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 73942-87-7 | Molecular Weight | 219.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 455.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | 246 °C | |
| MSDS | N/A | Flash Point | 229.5±28.7 °C | |
| Name | 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.8±45.0 °C at 760 mmHg |
| Melting Point | 246 °C |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.236 |
| Flash Point | 229.5±28.7 °C |
| Exact Mass | 219.089539 |
| PSA | 47.56000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | CPNZASIAJKSBBH-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)CC(=O)NC=C2 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933790090 |
|
~77%
7,8-Dimethoxy-1... CAS#:73942-87-7 |
| Literature: KRKA, D. D., NOVO MESTO; BOSE, Prosenjit; SIRIPALLI, Udaya Bhaskara Rao; KANDADAI, Appan Srinivas Patent: WO2010/72409 A1, 2010 ; Location in patent: Page/Page column 17-18 ; |
|
~%
7,8-Dimethoxy-1... CAS#:73942-87-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 5 p. 1496 - 1504 |
|
~%
7,8-Dimethoxy-1... CAS#:73942-87-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 5 p. 1496 - 1504 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one |
| 7,8-Dimethoxy-1,3-dihydro-2H-3-benzazepin-2-one |
| 2H-3-Benzazepin-2-one, 1,3-dihydro-7,8-dimethoxy- |
| 7,8-dimethoxy-1,3-dihydro-3-benzazepin-2-one |