foresaconitine
Modify Date: 2025-08-31 13:38:01
foresaconitine structure
|
Common Name | foresaconitine | ||
|---|---|---|---|---|
| CAS Number | 73870-35-6 | Molecular Weight | 627.765 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 663.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C35H49NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.0±31.5 °C | |
Use of foresaconitineForesaconitine(Vilmorrianine C) is a norditerpenoid alkaloid isolated from the processed tubers of Aconitum carmichaeli. |
| Name | vilmorrianine c |
|---|---|
| Synonym | More Synonyms |
| Description | Foresaconitine(Vilmorrianine C) is a norditerpenoid alkaloid isolated from the processed tubers of Aconitum carmichaeli. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 663.4±55.0 °C at 760 mmHg |
| Molecular Formula | C35H49NO9 |
| Molecular Weight | 627.765 |
| Flash Point | 355.0±31.5 °C |
| Exact Mass | 627.340759 |
| PSA | 101.99000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | LYUPEIXJYAJCHL-JMSIKOKPSA-N |
| SMILES | CCN1CC2(COC)CCC(OC)C34C5CC6C(OC)CC(OC(C)=O)(C5C6OC(=O)c5ccc(OC)cc5)C(C(OC)C23)C14 |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:100-09-4
CAS#:5066-78-4| 11aH-12,3,6a-Ethanylylidene-7,9-methanonaphth[2,3-b]azocine,aconitane-8,14-diol deriv. |
| (1α,6α,14α,16β)-8-(acetyloxy)-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate |
| (1α,6α,14α,16β)-8-Acetoxy-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate |
| Forresaconitine |
| Benzoic acid, 4-methoxy-, (1α,6α,14α,16β)-8-(acetyloxy)-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl ester |
| Foresachaconitine |
| foresaconitine |
| Chasmanine 8-acetate 14-(p-methoxybenzoate) |
| 3,13,15-Trideoxyjesaconitine |