H-Asp-oBzl structure
|
Common Name | H-Asp-oBzl | ||
|---|---|---|---|---|
| CAS Number | 7362-93-8 | Molecular Weight | 223.225 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 391.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | 176 °C | |
| MSDS | N/A | Flash Point | 190.3±26.5 °C | |
Use of H-Asp-oBzlL-Aspartic acid 1-benzyl ester is an aspartic acid derivative[1]. |
| Name | 1-Benzyl L-Aspartate |
|---|---|
| Synonym | More Synonyms |
| Description | L-Aspartic acid 1-benzyl ester is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.0±37.0 °C at 760 mmHg |
| Melting Point | 176 °C |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.225 |
| Flash Point | 190.3±26.5 °C |
| Exact Mass | 223.084457 |
| PSA | 89.62000 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | NJSRYBIBUXBNSW-VIFPVBQESA-N |
| SMILES | NC(CC(=O)O)C(=O)OCc1ccccc1 |
| Storage condition | Store at RT. |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . R40:Limited evidence of a carcinogenic effect. R43:May cause sensitization by skin contact. |
| Safety Phrases | S22-S26-S36 |
| WGK Germany | 3 |
| RTECS | TU3834000 |
| HS Code | 2922509090 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Aspartic acid, 1-(phenylmethyl) ester |
| benzyl hydrogen β-L-aspartate |
| MFCD00063186 |
| (3S)-3-Amino-4-(benzyloxy)-4-oxobutanoic acid |
| L-Aspartic acid benzyl ester |
| H-Asp-OBzl |