2,6-dihexylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone structure
|
Common Name | 2,6-dihexylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone | ||
|---|---|---|---|---|
| CAS Number | 7355-36-4 | Molecular Weight | 384.46900 | |
| Density | 1.19g/cm3 | Boiling Point | 531ºC at 760 mmHg | |
| Molecular Formula | C22H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | 2,6-dihexylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 531ºC at 760 mmHg |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.46900 |
| Flash Point | 222.6ºC |
| Exact Mass | 384.20500 |
| PSA | 78.14000 |
| LogP | 3.07300 |
| Index of Refraction | 1.562 |
| InChIKey | RCJOYJUVWIRYSF-UHFFFAOYSA-N |
| SMILES | CCCCCCn1c(=O)c2cc3c(=O)n(CCCCCC)c(=O)c3cc2c1=O |
|
~63%
2,6-dihexylpyrr... CAS#:7355-36-4 |
| Literature: Hamilton, Darren G.; Prodi, Luca; Feeder, Neil; Sanders, Jeremy K. M. Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 8 p. 1057 - 1065 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-Di-n-hexylpyromellitic diimide |
| N,N'-dihexyl-1,2:4,5-pyromellitdiimide |
| Hexyl pyromellitimide |