2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone
Modify Date: 2025-10-04 12:14:48
![2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone Structure](https://image.chemsrc.com/caspic/010/77762-96-0.png)
2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone structure
|
Common Name | 2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone | ||
|---|---|---|---|---|
| CAS Number | 77762-96-0 | Molecular Weight | 458.50900 | |
| Density | 1.368g/cm3 | Boiling Point | 655.2ºC at 760mmHg | |
| Molecular Formula | C26H26N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.8ºC | |
| Name | 2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 655.2ºC at 760mmHg |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.50900 |
| Flash Point | 291.8ºC |
| Exact Mass | 458.19500 |
| PSA | 84.62000 |
| InChIKey | YRZMBHQQRUEKRQ-UHFFFAOYSA-N |
| SMILES | O=c1c2cc3c(=O)n(CC#CCN4CCCC4)c(=O)c3cc2c(=O)n1CC#CCN1CCCC1 |
|
~59%
2,6-bis(4-pyrro... CAS#:77762-96-0 |
| Literature: Eldeen; Cosmo; Ghantous; Khayat European Journal of Medicinal Chemistry, 1981 , vol. 16, # 1 p. 91 - 93 |
|
~%
2,6-bis(4-pyrro... CAS#:77762-96-0 |
| Literature: Eldeen; Cosmo; Ghantous; Khayat European Journal of Medicinal Chemistry, 1981 , vol. 16, # 1 p. 91 - 93 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |