2-(Diphenylmethylene)-3-ethyl-1,3-oxazolidine-4,5-dione structure
|
Common Name | 2-(Diphenylmethylene)-3-ethyl-1,3-oxazolidine-4,5-dione | ||
|---|---|---|---|---|
| CAS Number | 7325-41-9 | Molecular Weight | 293.31700 | |
| Density | 1.244g/cm3 | Boiling Point | 408.7ºC at 760 mmHg | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201ºC | |
| Name | 2-benzhydrylidene-3-ethyl-1,3-oxazolidine-4,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 408.7ºC at 760 mmHg |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.31700 |
| Flash Point | 201ºC |
| Exact Mass | 293.10500 |
| PSA | 46.61000 |
| LogP | 2.74670 |
| Index of Refraction | 1.615 |
| InChIKey | ZIAPLCVLBBMDKV-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C(=O)OC1=C(c1ccccc1)c1ccccc1 |
|
~82%
2-(Diphenylmeth... CAS#:7325-41-9 |
| Literature: Szabo; Kuenzle; Mallat; Baiker Tetrahedron Asymmetry, 1999 , vol. 10, # 1 p. 61 - 76 |
|
~%
2-(Diphenylmeth... CAS#:7325-41-9 |
| Literature: Skinner; Perkins Journal of the American Chemical Society, 1950 , vol. 72, p. 5569,5573 |
| 2-Diphenylmethylen-3-phenyl-oxazolidin-4,5-dion |
| 3-ethyl-2-benzhydryliden-oxazolidine-4,5-dione |
| 2-(Diphenylmethylene)-3-ethyl-1,3-oxazolidine-4,5-dione |
| 3-Aethyl-2-benzhydryliden-oxazolidin-4,5-dion |
| 3-ethyl-2-diphenylmethyleneoxazoline-4,5-dione |
| 2-benzhydrylidene-3-ethyl-oxazolidine-4,5-dione |
| N-Ethyl-2-diphenylmethylen-oxazolidin-4,5-dion |