1-ethyl-4,4-diphenyl-pyrrolidine-2,3,5-trione
Modify Date: 2025-09-09 12:09:30
1-ethyl-4,4-diphenyl-pyrrolidine-2,3,5-trione structure
|
Common Name | 1-ethyl-4,4-diphenyl-pyrrolidine-2,3,5-trione | ||
|---|---|---|---|---|
| CAS Number | 5347-03-5 | Molecular Weight | 293.31700 | |
| Density | 1.255g/cm3 | Boiling Point | 431.7ºC at 760 mmHg | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
| Name | 1-ethyl-4,4-diphenylpyrrolidine-2,3,5-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 431.7ºC at 760 mmHg |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.31700 |
| Flash Point | 188.2ºC |
| Exact Mass | 293.10500 |
| PSA | 54.45000 |
| LogP | 1.86840 |
| Index of Refraction | 1.605 |
| InChIKey | FPHGWVDOCVTXQC-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C(=O)C(c2ccccc2)(c2ccccc2)C1=O |
|
~83%
1-ethyl-4,4-dip... CAS#:5347-03-5 |
| Literature: Szabo; Kuenzle; Mallat; Baiker Tetrahedron Asymmetry, 1999 , vol. 10, # 1 p. 61 - 76 |
|
~%
1-ethyl-4,4-dip... CAS#:5347-03-5 |
| Literature: Szabo; Kuenzle; Mallat; Baiker Tetrahedron Asymmetry, 1999 , vol. 10, # 1 p. 61 - 76 |
|
~%
1-ethyl-4,4-dip... CAS#:5347-03-5 |
| Literature: Skinner; Ludwig Journal of the American Chemical Society, 1956 , vol. 78, p. 4656,4657 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Aethyl-4,4-diphenyl-pyrrolidin-2,3,5-trion |
| 1-ethyl-4,4-diphenyl-pyrrolidine-2,3,5-trione |