2-Methyl-1H-indole-6-carboxylic acid structure
|
Common Name | 2-Methyl-1H-indole-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 73177-33-0 | Molecular Weight | 175.184 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 417.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.0±23.2 °C | |
| Name | 2-methyl-1H-indole-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 417.0±25.0 °C at 760 mmHg |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.184 |
| Flash Point | 206.0±23.2 °C |
| Exact Mass | 175.063324 |
| PSA | 53.09000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | DTOBYAWCBMAUQH-UHFFFAOYSA-N |
| SMILES | Cc1cc2ccc(C(=O)O)cc2[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
2-Methyl-1H-ind... CAS#:73177-33-0 |
| Literature: Bard, Raymond R.; Bunnett, Joseph F. Journal of Organic Chemistry, 1980 , vol. 45, # 8 p. 1546 - 1547 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-6-carboxyindole |
| 2-methylindole-6-carboxylic acid |
| 2-Methyl-1H-indole-6-carboxylic acid |
| 1H-Indole-6-carboxylic acid, 2-methyl- |