Pentafluorobenzenesulfonyl fluorescein
Modify Date: 2025-08-26 19:38:22
Pentafluorobenzenesulfonyl fluorescein structure
|
Common Name | Pentafluorobenzenesulfonyl fluorescein | ||
|---|---|---|---|---|
| CAS Number | 728912-45-6 | Molecular Weight | 562.42 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 707.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H11F5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 381.6±32.9 °C | |
Use of Pentafluorobenzenesulfonyl fluoresceinPentafluorobenzenesulfonyl fluorescein is a H2O2-selective sensor that can be used to detect H2O2 levels in cells. Pentafluorobenzenesulfonyl fluorescein is normally non-fluorescent but fluoresces upon perhydrolysis of the sulfonyl linkage by H2O2[1]. |
| Name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Pentafluorobenzenesulfonyl fluorescein is a H2O2-selective sensor that can be used to detect H2O2 levels in cells. Pentafluorobenzenesulfonyl fluorescein is normally non-fluorescent but fluoresces upon perhydrolysis of the sulfonyl linkage by H2O2[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 707.3±60.0 °C at 760 mmHg |
| Molecular Formula | C26H11F5O7S |
| Molecular Weight | 562.42 |
| Flash Point | 381.6±32.9 °C |
| Exact Mass | 562.014587 |
| PSA | 107.51000 |
| LogP | 5.08 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | UIBLLPHZQUTIBL-UHFFFAOYSA-N |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(OS(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)ccc32)c2ccccc21 |
| Storage condition | -20°C |
| 6'-Hydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-3'-yl pentafluorobenzenesulfonate |
| Hydrogen Peroxide Probe,Fluorogenic |
| Pentafluorobenzenesulfonyl fluorescein |
| Benzenesulfonic acid, 2,3,4,5,6-pentafluoro-, 6'-hydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3'-yl ester |