2',4',6'-Trihydroxy-2-phenylacetophenone
2',4',6'-Trihydroxy-2-phenylacetophenone structure
|
Common Name | 2',4',6'-Trihydroxy-2-phenylacetophenone | ||
|---|---|---|---|---|
| CAS Number | 727-71-9 | Molecular Weight | 244.24300 | |
| Density | 1.38g/cm3 | Boiling Point | 441.5ºC at 760 mmHg | |
| Molecular Formula | C14H12O4 | Melting Point | 161-165ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 234.9ºC | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
| Name | 2,4,6-trihydroxy phenyl benzyl ketone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 441.5ºC at 760 mmHg |
| Melting Point | 161-165ºC(lit.) |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24300 |
| Flash Point | 234.9ºC |
| Exact Mass | 244.07400 |
| PSA | 77.76000 |
| LogP | 2.22880 |
| Index of Refraction | 1.674 |
| InChIKey | SLHBRIIHMDJIBT-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1c(O)cc(O)cc1O |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H400 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R41 |
| Safety Phrases | S37-S39 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2914501900 |
|
~71%
2',4',6'-Trihyd... CAS#:727-71-9 |
| Literature: Ng, Lean-Teik; Ko, Horng-Huey; Lu, Tzy-Ming Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 13 p. 4360 - 4366 |
|
~40%
2',4',6'-Trihyd... CAS#:727-71-9 |
| Literature: Lin, Chun-Mao; Huang, Sheng-Tung; Lee, Fu-Wei; Kuo, Hsien-Saw; Lin, Mei-Hsiang Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 13 p. 4402 - 4409 |
|
~%
2',4',6'-Trihyd... CAS#:727-71-9 |
| Literature: US5235109 A1, ; |
|
~%
2',4',6'-Trihyd... CAS#:727-71-9 |
| Literature: Bulletin de la Societe Chimique de France, , p. 2309 - 2322 |
|
~49%
2',4',6'-Trihyd... CAS#:727-71-9 |
| Literature: Devi, Nirada; Jain, Niveta; Krishnamurty, H. G. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 8 p. 874 - 875 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
CAS#:4222-02-0
CAS#:143207-80-1
CAS#:4044-00-2
CAS#:26964-35-2
CAS#:39604-66-5
CAS#:844-95-1| HS Code | 2914501900 |
|---|---|
| Summary | 2914501900 other ketone-phenols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (phenylmethyl)-(2,4,6-trihydroxyphenyl)-ketone |
| 2,3-DIHYDROXY-DL-PHENYLALANINE |
| 2-PHENYL-1-(2,4,6-TRIHYDROXYPHENYL)ETHAN-1-ONE |
| 2-PHENYL-2',4',6'-TRIHYDROXYACETOPHENONE |
| 2,4,6-trihydroxyphenylbenzylketone |
| 1-(2,4,6-TRIHYDROXYPHENYL)-2-PHENYLETHANONE |
| MFCD00205539 |
| 2-phenyl-1-(2,4,6-trihydroxyphenyl)ethanone |