5,7-DIMETHOXYISOFLAVONE structure
|
Common Name | 5,7-DIMETHOXYISOFLAVONE | ||
|---|---|---|---|---|
| CAS Number | 26964-35-2 | Molecular Weight | 282.29100 | |
| Density | 1.242g/cm3 | Boiling Point | 476.6ºC at 760mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 5,7-dimethoxy-3-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 476.6ºC at 760mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 213.5ºC |
| Exact Mass | 282.08900 |
| PSA | 48.67000 |
| LogP | 3.47720 |
| Vapour Pressure | 3.01E-09mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | CDSSYLTXYXEANW-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccccc3)coc2c1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,7-Dimethoxyisoflavon |
| 5,7-dimethoxyisoflavone |
| 5,7-dimethoxy-3-phenyl-chromen-4-one |
| 5,7-dimethoxy-3-phenyl-4H-chromen-4-one |
| 5,7-Dimethoxy-3-phenyl-chromen-4-on |