linustatin structure
|
Common Name | linustatin | ||
|---|---|---|---|---|
| CAS Number | 72229-40-4 | Molecular Weight | 409.39 | |
| Density | 1.56g/cm3 | Boiling Point | 703.6ºC at 760 mmHg | |
| Molecular Formula | C16H27NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 379.3ºC | |
Use of linustatinLinustatin is a cyanogenic glycoside that can be isolated from linseed meal[1]. |
| Name | linustatin |
|---|
| Description | Linustatin is a cyanogenic glycoside that can be isolated from linseed meal[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 703.6ºC at 760 mmHg |
| Molecular Formula | C16H27NO11 |
| Molecular Weight | 409.39 |
| Flash Point | 379.3ºC |
| Exact Mass | 409.15800 |
| PSA | 202.32000 |
| Index of Refraction | 1.601 |
| InChIKey | FERSMFQBWVBKQK-CXTTVELOSA-N |
| SMILES | CC(C)(C#N)OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |