1,3-Butanedione, 4,4,4-trifluoro-1-p-tolyl- structure
|
Common Name | 1,3-Butanedione, 4,4,4-trifluoro-1-p-tolyl- | ||
|---|---|---|---|---|
| CAS Number | 720-94-5 | Molecular Weight | 230.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 269.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O2 | Melting Point | 44-46ºC | |
| MSDS | N/A | Flash Point | 94.1±22.8 °C | |
| Name | 4,4,4-Trifluoro-1-(4-methylphenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.9±35.0 °C at 760 mmHg |
| Melting Point | 44-46ºC |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.183 |
| Flash Point | 94.1±22.8 °C |
| Exact Mass | 230.055466 |
| PSA | 34.14000 |
| LogP | 4.63 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | WRZMHTIRFOFFPY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CC(=O)C(F)(F)F)cc1 |
| Storage condition | -20°C Freezer |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
|
~99%
1,3-Butanedione... CAS#:720-94-5 |
| Literature: Lill, Andreas; Scholich, Klaus; Stark, Holger Tetrahedron Letters, 2013 , vol. 54, # 49 p. 6682 - 6686 |
|
~84%
1,3-Butanedione... CAS#:720-94-5 |
| Literature: Merck Frosst Canada and Co. Patent: US6150534 A1, 2000 ; |
|
~%
1,3-Butanedione... CAS#:720-94-5 |
| Literature: US2008/234491 A1, ; Page/Page column 3-4 ; |
|
~%
1,3-Butanedione... CAS#:720-94-5 |
| Literature: US2008/234491 A1, ; Page/Page column 4 ; |
|
~%
1,3-Butanedione... CAS#:720-94-5 |
| Literature: US2001/47023 A1, ; |
|
~92%
1,3-Butanedione... CAS#:720-94-5 |
| Literature: Ahlstroem, Marie M.; Ridderstroem, Marianne; Zamora, Ismael; Luthman, Kristina Journal of Medicinal Chemistry, 2007 , vol. 50, # 18 p. 4444 - 4452 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,3-Butanedione, 4,4,4-trifluoro-1-p-tolyl- |
| 4,4,4-Trifluor-1-(4-methylphenyl)butan-1,3-dion |
| 4,4,4-Trifluoro-1-(4-methylphenyl)butane-1,3-dione |
| 1,3-Butanedione, 4,4,4-trifluoro-1-(4-methylphenyl)- |
| 4,4,4-Trifluoro-1-(4-methylphenyl)-1,3-butanedione |
| 4,4,4-trifluoro-1-[4-(methyl)phenyl]-butane-1,3-dione |
| MFCD00517909 |