1-(4-Carboxyphenyl)-1H-indole-5-carboxylic acid structure
|
Common Name | 1-(4-Carboxyphenyl)-1H-indole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 71935-16-5 | Molecular Weight | 281.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-carboxyphenyl)indole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11NO4 |
|---|---|
| Molecular Weight | 281.26300 |
| Exact Mass | 281.06900 |
| PSA | 79.53000 |
| LogP | 3.02690 |
| InChIKey | BJHWREWVNAYEAK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-n2ccc3cc(C(=O)O)ccc32)cc1 |
|
~93%
1-(4-Carboxyphe... CAS#:71935-16-5 |
| Literature: Merck and Co., Inc. Patent: US4156734 A1, 1979 ; |
|
~93%
1-(4-Carboxyphe... CAS#:71935-16-5 |
| Literature: Zhang, Yihua; Yang, Xinye; Xing, Hui; Zhang, Ye; Lai, Yisheng; Jiang, Yongwen; Ma, Dawei Chinese Journal of Chemistry, 2012 , vol. 30, # 4 p. 875 - 880 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 4-(5-(Methoxycarbonyl)-1H-indol-1-yl)benzoic acid |
| 4-(5-Fluoro-1H-indol-1-yl)benzoic acid |
| 1-(4-Carboxyphenyl)-1H-indole-6-carboxylic acid |
| 4-(5-Methoxy-1H-indol-1-yl)benzoic acid |
| 4-(5-Cyano-1H-indol-1-yl)benzoic acid |
| 1-(4-CARBOXYPHENYL)-1H-INDOLE-5-CARBOXYLIC ACID |
| p-(indol-1-yl)benzoic acid |
| 4-(1H-Indol-1-yl)benzoic acid |
| 1-p-Carboxyphenyl-indol |
| 4-(5-Chloro-1H-indol-1-yl)benzoic acid |
| Benzoic acid,4-(1H-indol-1-yl) |