Calcium 2-oxopentanedioate structure
|
Common Name | Calcium 2-oxopentanedioate | ||
|---|---|---|---|---|
| CAS Number | 71686-01-6 | Molecular Weight | 184.160 | |
| Density | N/A | Boiling Point | 345.6ºC at 760 mmHg | |
| Molecular Formula | C5H4CaO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
Use of Calcium 2-oxopentanedioate2-Ketoglutaric acid calcium (Alpha-Ketoglutaric acid calcium) is an intermediate in the production of ATP or GTP in the Krebs cycle. 2-Ketoglutaric acid calcium also acts as the major carbon skeleton for nitrogen-assimilatory reactions. 2-Ketoglutaric acid calcium is a reversible inhibitor of tyrosinase (IC50=15 mM)[1][2]. |
| Name | calcium,2-oxopentanedioate |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Ketoglutaric acid calcium (Alpha-Ketoglutaric acid calcium) is an intermediate in the production of ATP or GTP in the Krebs cycle. 2-Ketoglutaric acid calcium also acts as the major carbon skeleton for nitrogen-assimilatory reactions. 2-Ketoglutaric acid calcium is a reversible inhibitor of tyrosinase (IC50=15 mM)[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Tyrosinase:15 mM (IC50) Human Endogenous Metabolite |
| In Vitro | 2-Ketoglutaric acid calcium (Alpha-Ketoglutaric acid calcium) has other physiological capabilities including reduction of ammonia level formed in the lung and general ammonia detoxification, protective role against lipid peroxidation and neuroprotective effect against cyanide poisoning[1]. 2-Ketoglutaric acid calcium acts as precursor for the synthesis of amino acids and nucleotides[2]. |
| References |
| Boiling Point | 345.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C5H4CaO5 |
| Molecular Weight | 184.160 |
| Flash Point | 177ºC |
| Exact Mass | 183.968460 |
| PSA | 69.67000 |
| InChIKey | LADYPAWUSNPKJF-UHFFFAOYSA-L |
| SMILES | O=C([O-])CCC(=O)C(=O)[O-].[Ca+2] |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 275-843-2 |
| Pentanedioic acid, 2-oxo-, calcium salt (1:1) |
| MFCD02683879 |
| calcium 2-oxidanylidenepentanedioate |
| 2-oxo-glutaric acid,calcium salt |
| 2-Oxo-glutarsaeure,Calcium-Salz |
| Calcium 2-oxopentanedioate |
| Calcium 2-oxoglutarate |