H-His-NH2.2HCl
Modify Date: 2025-08-25 18:28:23
H-His-NH2.2HCl structure
|
Common Name | H-His-NH2.2HCl | ||
|---|---|---|---|---|
| CAS Number | 71666-95-0 | Molecular Weight | 227.09200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H12Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanamide,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H12Cl2N4O |
|---|---|
| Molecular Weight | 227.09200 |
| Exact Mass | 226.03900 |
| PSA | 97.79000 |
| LogP | 1.76940 |
| Appearance of Characters | Solid |
| InChIKey | CRBYFJCXMZNLTO-XRIGFGBMSA-N |
| SMILES | Cl.Cl.NC(=O)C(N)Cc1cnc[nH]1 |
| Storage condition | −20°C |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| H-His-NH2.2HCl |
| 1H-Imidazole-4-propanamide,a-amino-,dihydrochloride,(S) |
| H-His-NH2A'A inverted exclamation markA'A currency2HCl |