H-His-Pro-OH hydrochloride salt structure
|
Common Name | H-His-Pro-OH hydrochloride salt | ||
|---|---|---|---|---|
| CAS Number | 20930-58-9 | Molecular Weight | 252.27000 | |
| Density | 1.433g/cm3 | Boiling Point | 638.374ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.876ºC | |
Use of H-His-Pro-OH hydrochloride saltHis-Pro is a dipeptide consisting of histidyl and proline. |
| Name | H-His-Pro-OH |
|---|---|
| Synonym | More Synonyms |
| Description | His-Pro is a dipeptide consisting of histidyl and proline. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 638.374ºC at 760 mmHg |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27000 |
| Flash Point | 339.876ºC |
| Exact Mass | 252.12200 |
| PSA | 112.31000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | LNCFUHAPNTYMJB-IUCAKERBSA-N |
| SMILES | NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)O |
| 1-histidyl-proline |
| histidylproline |