(1R,2R)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol structure
|
Common Name | (1R,2R)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 716-61-0 | Molecular Weight | 212.203 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 451.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H12N2O4 | Melting Point | 163-165ºC | |
| MSDS | Chinese USA | Flash Point | 227.1±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (1R,2R)-2-Amino-1-(4-nitrophenyl)propane-1,3-diolChloramphenicol base is a bioactive chemical. |
| Name | (R,R)-2-amino-1-(4-nitrophenyl)propane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.9±45.0 °C at 760 mmHg |
| Melting Point | 163-165ºC |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.203 |
| Flash Point | 227.1±28.7 °C |
| Exact Mass | 212.079712 |
| PSA | 112.30000 |
| LogP | 0.13 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | OCYJXSUPZMNXEN-RKDXNWHRSA-N |
| SMILES | NC(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| Storage condition | −20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 3259 |
| WGK Germany | 3 |
| RTECS | TY3100000 |
|
[Studies on the resolution of racemic gossypol. IV. Use of threo (-) or (+)-1-(p-nitrophenyl)-1,3-dihydroxypropylamine-2 as the resolving agent].
Yao Xue Xue Bao 25(6) , 430-4, (1990) Threo (-) or (+)-1-(p-nitrophenyl)-1,3-dihydroxypropylamine-2 was found to be a useful resolving agent for racemic gossypol. The optical and chemical stability of the condensate of enantiomeric gossyp... |
|
|
Investigation of Batten disease with the yeast Saccharomyces cerevisiae.
Mol. Genet. Metab. 66(4) , 314-9, (1999) The CLN3 gene, which encodes the protein whose absence is responsible for Batten disease, the most common inherited neurovisceral storage disease of childhood, was identified in 1995. The function of ... |
|
|
High-performance liquid chromatographic determination of chloramphenicol and 2-amino-1-(p-nitrophenyl)-1,3-propanediol in pharmaceutical formulations.
J. Chromatogr. A. 170(1) , 282-7, (1979)
|
| 2-Amino-1-(4-nitrophenyl)-1,3-propanediol |
| 2-amino-1-(4-nitrophenyl)propane-1,3-diol |
| D-(-)-threo-2-Amino-1-(p-nitrophenyl)-1,3-propanediol |
| (1R,2R)-2-amino-1-(4-nitrophenyl)propane-1,3-diol |
| D-threo-2-Amino-1-(4-nitrophenyl)-1,3-propanediol |
| 1,3-Propanediol, 2-amino-1-(4-nitrophenyl)- |
| D-threo-(-)-2-Amino-1-(p-nitrophenyl)-1,3-propanediol |
| D-(-)-THREO-2-AMINO-1-(4-NITROPHENYL)-1,3-PROPANEDIOL |
| 1-(p-nitrophenyl)-2-amino-1,3-propanediol |
| MFCD00078126 |
| 1,3-Propanediol, 2-amino-1- (p-nitrophenyl)- |
| 1,3-Propanediol, 2-amino-1- (4-nitrophenyl)- |
| 1,3-Propanediol, 2-amino-1-(p-nitrophenyl)-, D-threo-(-)- |
| EINECS 211-938-7 |