Bilanafos-sodium
Modify Date: 2025-08-26 04:45:48
Bilanafos-sodium structure
|
Common Name | Bilanafos-sodium | ||
|---|---|---|---|---|
| CAS Number | 71048-99-2 | Molecular Weight | 345.264 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21N3NaO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bilanafos-sodiumBialaphos is a natural non-selective phytotoxin produced by certain Streptomyces species. It is a pro-toxin, a tripeptide that is converted in vivo to the active agent phosphinothricin, which is a glutamine analog. L-Phosphinothricin inhibits glutamine synthetase (Ki = 6.1 μM), resulting in accumulation of ammonium and disruption of primary metabolism. The bacterial bar gene encodes a phosphinothricin acetyltransferase, which confers resistance to phosphinothricin.3 Bialaphos is used in the selection of transgenic plants that express the bar gene, usually under the control of a constitutively active viral promoter. |
| Name | bilanafos-sodium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H21N3NaO6P |
|---|---|
| Molecular Weight | 345.264 |
| Exact Mass | 345.106567 |
| PSA | 178.44000 |
| LogP | 0.95140 |
| InChIKey | RTWIRLHWLMNVCC-WQYNNSOESA-M |
| SMILES | CC(NC(=O)C(C)NC(=O)C(N)CCP(C)(=O)O)C(=O)[O-].[Na+] |
| Meiji herbiace |
| Bialaphos sodium |
| Bilanafos-sodium |
| sodium,2-[2-[[2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl]amino]propanoylamino]propanoate |
| Bilanafos-sodium [ISO] |
| bialaphos-sodium |
| sodium (2S)-2-amino-4-(methylphosphinato)butyryl-L-alanyl-L-alanine |
| Sodium L-2-amino-4-((hydroxy)(methyl)phosphinoyl)butyryl-L-alanyl-L-alanine |
| SF 1293 |
| Sodium (2S)-2-[(N-{(2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl}-L-alanyl)amino]propanoate |
| MW 801 |
| (2S)-2-amino-4-(hydroxymethylphosphinyl)butanoyl-L-alanyl-L-alanine monosodium salt |
| L-Alanine, N-[(2S)-2-amino-4-(hydroxymethylphosphinyl)-1-oxobutyl]-L-alanyl-, sodium salt (1:1) |
| sodium 2-[(n-{2-amino-4-[hydroxy(methyl)phosphoryl]butanoyl}alanyl)amino]propanoate |