FPH1
Modify Date: 2025-08-22 14:41:22
FPH1 structure
|
Common Name | FPH1 | ||
|---|---|---|---|---|
| CAS Number | 708219-39-0 | Molecular Weight | 388.81700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClF2N2O3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of FPH1FPH1(BRD-6125) increases the number and activity of primary human hepatocytes in vitro and promotes the differentiation of iPS cells towards a hepatic lineage[1]. |
| Name | Acetamide, 2-[(5-chloro-2-methylphenyl)(methylsulfonyl)amino]-N-(2,6-difluorophenyl) |
|---|---|
| Synonym | More Synonyms |
| Description | FPH1(BRD-6125) increases the number and activity of primary human hepatocytes in vitro and promotes the differentiation of iPS cells towards a hepatic lineage[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H15ClF2N2O3S |
|---|---|
| Molecular Weight | 388.81700 |
| Exact Mass | 388.04600 |
| PSA | 74.86000 |
| LogP | 4.48510 |
| InChIKey | WAOBCCBUTHNTFO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)cc1N(CC(=O)Nc1c(F)cccc1F)S(C)(=O)=O |
| Storage condition | -20℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| BRD-6125 |
| FPH1 |