beta-L-D4A
Modify Date: 2025-08-25 11:18:13
beta-L-D4A structure
|
Common Name | beta-L-D4A | ||
|---|---|---|---|---|
| CAS Number | 7057-48-9 | Molecular Weight | 233.22700 | |
| Density | 1.74 g/cm3 | Boiling Point | 553.9ºC at 760 mmHg | |
| Molecular Formula | C10H11N5O2 | Melting Point | 187-189ºC | |
| MSDS | N/A | Flash Point | 288.8ºC | |
Use of beta-L-D4ANSC 108602 is a nucleoside HIV-1 reverse transcriptase inhibitor. |
| Name | 2',3'-dideoxy-2',3'-didehydroadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | NSC 108602 is a nucleoside HIV-1 reverse transcriptase inhibitor. |
|---|---|
| Related Catalog | |
| Target |
HIV-1 |
| In Vitro | NSC 108602 (d4A) is a nucleoside HIV-1 reverse transcriptase inhibitor. Results confirm that the biological activity of NSC 108602 is connected with the termination of the DNA chain synthesis in the 5′-3′ direction[1]. |
| References |
| Density | 1.74 g/cm3 |
|---|---|
| Boiling Point | 553.9ºC at 760 mmHg |
| Melting Point | 187-189ºC |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.22700 |
| Flash Point | 288.8ºC |
| Exact Mass | 233.09100 |
| PSA | 99.08000 |
| LogP | 0.43560 |
| Index of Refraction | 1.822 |
| InChIKey | JFUOUIPRAAGUGF-NKWVEPMBSA-N |
| SMILES | Nc1ncnc2c1ncn2C1C=CC(CO)O1 |
| Hazard Codes | Xn |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4097-22-7| D4A |
| 2',3'-Dideoxy-2'3'-didehy... |
| 2'3'-didehydro-2'3'-dideoxyadenosine |
| ((2S,5R)-5-(6-Amino-9H-purin-9-yl)-2,5-dihydrofuran-2-yl)methanol |