3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl chloride structure
|
Common Name | 3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 70262-57-6 | Molecular Weight | 291.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8Cl2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-5,6-dimethoxy-1-benzothiophene-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8Cl2O3S |
|---|---|
| Molecular Weight | 291.15000 |
| Exact Mass | 289.95700 |
| PSA | 63.77000 |
| LogP | 3.95090 |
| InChIKey | FPOJTIOYSDDNKZ-UHFFFAOYSA-N |
| SMILES | COc1cc2sc(C(=O)Cl)c(Cl)c2cc1OC |
|
~%
3-chloro-5,6-di... CAS#:70262-57-6 |
| Literature: Connor; Cetenko; Mullican; Sorenson; Unangst; Weikert; Adolphson; Kennedy; Thueson; Wright; Conroy Journal of Medicinal Chemistry, 1992 , vol. 35, # 5 p. 958 - 965 |
|
~31%
3-chloro-5,6-di... CAS#:70262-57-6 |
| Literature: Stuart; Khora; McKenney Jr.; Castle Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 6 p. 1589 - 1594 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-chloro-5,6-dimethoxybenzo[b]thiophene-2-carbonyl chloride |
| Benzo[b]thiophene-2-carbonyl chloride,3-chloro-5,6-dimethoxy |