bis(4-methoxyphenyl)-dimethylsilane
Modify Date: 2025-09-18 09:55:56
bis(4-methoxyphenyl)-dimethylsilane structure
|
Common Name | bis(4-methoxyphenyl)-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 69983-36-4 | Molecular Weight | 272.41400 | |
| Density | 1.03g/cm3 | Boiling Point | 340.7ºC at 760 mmHg | |
| Molecular Formula | C16H20O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.3ºC | |
| Name | bis(4-methoxyphenyl)-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 340.7ºC at 760 mmHg |
| Molecular Formula | C16H20O2Si |
| Molecular Weight | 272.41400 |
| Flash Point | 126.3ºC |
| Exact Mass | 272.12300 |
| PSA | 18.46000 |
| LogP | 2.52640 |
| Index of Refraction | 1.537 |
| InChIKey | OUGNJHFOQCLTPR-UHFFFAOYSA-N |
| SMILES | COc1ccc([Si](C)(C)c2ccc(OC)cc2)cc1 |
|
~71%
bis(4-methoxyph... CAS#:69983-36-4 |
| Literature: Van Der Vlugt, Jarl Ivar; Bonet, Josep M.; Mills, Allison M.; Spek, Anthony L.; Vogt, Dieter Tetrahedron Letters, 2003 , vol. 44, # 23 p. 4389 - 4392 |
|
~69%
bis(4-methoxyph... CAS#:69983-36-4 |
| Literature: Walree, Cornelis A. van; Lauteslager, Xavier Y.; Wageningen, Andreas M. A. van; Zwikker, Jan W.; Jenneskens, Leonardus W. Journal of Organometallic Chemistry, 1995 , vol. 496, # 1 p. 117 - 126 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Silane,bis(4-methoxyphenyl)dimethyl-(9CI) |
| Dimethyl-bis-(p-anisyl)-silan |
| AMTSi043 |
| Bis(4-methoxyphenyl)dimethylsilane |
| di(4-methoxyphenyl)dimethylsilane |
| Bis(4-methyoxyphenyl)dimethylsilane |