haloxyfop-methyl structure
|
Common Name | haloxyfop-methyl | ||
|---|---|---|---|---|
| CAS Number | 69806-40-2 | Molecular Weight | 375.73 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 390.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H13ClF3NO4 | Melting Point | 55-57ºC | |
| MSDS | Chinese USA | Flash Point | 190.2±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of haloxyfop-methylHaloxyfop-methyl is a high-efficacy herbicide. Haloxyfop-methyl selectively controls several annual and perennial grasses in soybeans and other dicotyledenous crops[1]. |
| Name | haloxyfop-methyl |
|---|---|
| Synonym | More Synonyms |
| Description | Haloxyfop-methyl is a high-efficacy herbicide. Haloxyfop-methyl selectively controls several annual and perennial grasses in soybeans and other dicotyledenous crops[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.8±42.0 °C at 760 mmHg |
| Melting Point | 55-57ºC |
| Molecular Formula | C16H13ClF3NO4 |
| Molecular Weight | 375.73 |
| Flash Point | 190.2±27.9 °C |
| Exact Mass | 375.048523 |
| PSA | 57.65000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | MFSWTRQUCLNFOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| RTECS | UA2458270 |
| HS Code | 2933399025 |
|
~%
Detail
|
| Literature: US5049675 A1, ; |
| HS Code | 2933399025 |
|---|---|
| Summary | 2933399025. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:20.0% |
| rac-methyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| methyl 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate |
| methyl 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| MFCD01310644 |
| UNII:6HO742968B |
| Methyl 2-(4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoate |
| Methyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| Propanoic acid, 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, methyl ester |
| 2-[4-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid methyl ester |
| Methyl-2-[4-(3-chloro-5- trifluoromethyl-2-pyridyloxy) phenoxy]propionate |
| haloxyfop-methyl |
| Haloxyfop methyl ester |
| methyl (RS)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionate |