2-Chloro-6,7-dimethoxy-4-methylquinoline
Modify Date: 2025-08-26 19:36:35
2-Chloro-6,7-dimethoxy-4-methylquinoline structure
|
Common Name | 2-Chloro-6,7-dimethoxy-4-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 697793-63-8 | Molecular Weight | 237.68200 | |
| Density | 1.231g/cm3 | Boiling Point | 357ºC at 760 mmHg | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 169.7ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-Chloro-6,7-dimethoxy-4-methylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760 mmHg |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.68200 |
| Flash Point | 169.7ºC |
| Exact Mass | 237.05600 |
| PSA | 31.35000 |
| LogP | 3.21380 |
| Index of Refraction | 1.591 |
| InChIKey | JWSDOYINPAVDIM-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(Cl)cc(C)c2cc1OC |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
|
~%
2-Chloro-6,7-di... CAS#:697793-63-8 |
| Literature: Levitz; Bogert Journal of Organic Chemistry, 1945 , vol. 10, p. 341,345 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-6,7-dimethoxy-4-methyl-quinoline |
| 2-Chlor-6,7-dimethoxy-4-methyl-chinolin |