2-chloro-6,8-diMethoxy-4-Methylquinoline structure
|
Common Name | 2-chloro-6,8-diMethoxy-4-Methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 938459-20-2 | Molecular Weight | 237.68200 | |
| Density | 1.231g/cm3 | Boiling Point | 376.3ºC at 760 mmHg | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 2-chloro-6,8-diMethoxy-4-Methylquinoline |
|---|
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 376.3ºC at 760 mmHg |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.68200 |
| Flash Point | 181.4ºC |
| Exact Mass | 237.05600 |
| PSA | 31.35000 |
| LogP | 3.21380 |
| Index of Refraction | 1.591 |
| InChIKey | FTTISRVTEBJLDA-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2nc(Cl)cc(C)c2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |