b-D-Ribofuranose 1-acetate 2,3,5-tribenzoate structure
|
Common Name | b-D-Ribofuranose 1-acetate 2,3,5-tribenzoate | ||
|---|---|---|---|---|
| CAS Number | 6974-32-9 | Molecular Weight | 504.485 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 621.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H24O9 | Melting Point | 128-130ºC | |
| MSDS | N/A | Flash Point | 264.3±31.5 °C | |
| Name | 1-O-Acetyl-2,3,5-Tri-O-Benzoyl-Beta-D-Ribofuranose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 621.0±55.0 °C at 760 mmHg |
| Melting Point | 128-130ºC |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.485 |
| Flash Point | 264.3±31.5 °C |
| Exact Mass | 504.142029 |
| PSA | 114.43000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | GCZABPLTDYVJMP-VWCYVRSESA-N |
| SMILES | CC(=O)OC1OC(COC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| Storage condition | 2~8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| (2S,3R,4R,5R)-2-Acetoxy-5-[(benzoyloxy)methyl]tetrahydrofuran-3,4-diyl dibenzoate |
| 1-O-Acetyl-2,3,5-tri-O-benzoyl-β-D-ribofuranose |
| b-D-Ribofuranose 1-acetate 2,3,5-tribenzoate |
| β-D-Ribofuranose, 1-acetate 2,3,5-tribenzoate |
| Ribofuranose, 1-acetate 2,3,5-tribenzoate, .β.-D- |
| EINECS 230-220-4 |
| β-D-Ribofuranose-1-acetate-2,3,5-tribenzoate |
| 1-O-Acetyl-2,3,5-tris-O-(phenylcarbonyl)-β-D-ribofuranose |
| MFCD00005357 |