2-Propen-1-one,3-(4-hydroxyphenyl)-1-(4-methoxyphenyl)-
Modify Date: 2025-08-31 18:15:37
2-Propen-1-one,3-(4-hydroxyphenyl)-1-(4-methoxyphenyl)- structure
|
Common Name | 2-Propen-1-one,3-(4-hydroxyphenyl)-1-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 69704-15-0 | Molecular Weight | 254.28100 | |
| Density | 1.197g/cm3 | Boiling Point | 443.3ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | 4-hydroxy-4'-methoxychalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 443.3ºC at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 166.6ºC |
| Exact Mass | 254.09400 |
| PSA | 46.53000 |
| LogP | 3.29690 |
| Index of Refraction | 1.631 |
| InChIKey | WSEGRADBFAKNHQ-NYYWCZLTSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(O)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
|
~76%
2-Propen-1-one,... CAS#:69704-15-0 |
| Literature: Solhy; Tahir; Sebti; Skouta; Bousmina; Zahouily; Larzek Applied Catalysis A: General, 2010 , vol. 374, # 1-2 p. 189 - 193 |
|
~%
2-Propen-1-one,... CAS#:69704-15-0 |
| Literature: Molecular Crystals and Liquid Crystals, , vol. 441, p. 153 - 161 |
|
~%
2-Propen-1-one,... CAS#:69704-15-0 |
| Literature: Molecular Crystals and Liquid Crystals, , vol. 441, p. 153 - 161 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Hydroxy-4'-methoxy-chalkon |
| 4-Hydroxy-4'-methoxychalcon |
| 4-hydroxy-4'-methoxy-chalcone |
| 4'-Methoxy-4-hydroxy-chalkon |
| 4'-hydroxy-4-methoxybenzalazetophenone |