1,2,4-Triazolidine-3,5-dione,1-phenyl- structure
|
Common Name | 1,2,4-Triazolidine-3,5-dione,1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6942-46-7 | Molecular Weight | 177.16000 | |
| Density | 1.373g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H7N3O2 | Melting Point | 268-270ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Melting Point | 268-270ºC |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16000 |
| Exact Mass | 177.05400 |
| PSA | 70.65000 |
| Index of Refraction | 1.6 |
| InChIKey | WFYLHMAYBQLBEM-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)[nH]1 |
| Safety Phrases | 22-24/25 |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| phenylurazol |
| 1-phenylurazol |
| 3,5-dioxo-1-phenyl-1,2,4-triazolidine |
| 1-Phenylurazole |
| Bicarbamimide,2-phenyl |
| 1-phenyl-1h-1,2,4-triazole-3,5-diol |
| phenyl urazole |