N'-(4-Dimethylaminobenzyl)acetohydrazide structure
|
Common Name | N'-(4-Dimethylaminobenzyl)acetohydrazide | ||
|---|---|---|---|---|
| CAS Number | 69352-47-2 | Molecular Weight | 207.27200 | |
| Density | 1.121g/cm3 | Boiling Point | 358.8ºC at 760 mmHg | |
| Molecular Formula | C11H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8ºC | |
| Name | N-[[4-(dimethylamino)phenyl]methyl]acetohydrazide |
|---|
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 358.8ºC at 760 mmHg |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.27200 |
| Flash Point | 170.8ºC |
| Exact Mass | 207.13700 |
| PSA | 49.57000 |
| LogP | 1.67510 |
| Index of Refraction | 1.586 |
| InChIKey | GVIBQRCUHIQAAP-UHFFFAOYSA-N |
| SMILES | CC(=O)N(N)Cc1ccc(N(C)C)cc1 |
|
~%
N'-(4-Dimethyla... CAS#:69352-47-2 |
| Literature: Gardner,T.S. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 503 - 513 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |