Benzylmagnesium chloride structure
|
Common Name | Benzylmagnesium chloride | ||
|---|---|---|---|---|
| CAS Number | 6921-34-2 | Molecular Weight | 150.88800 | |
| Density | 1.031 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C7H7ClMg | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 1 °F | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | Benzylmagnesium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031 g/mL at 25 °C |
|---|---|
| Molecular Formula | C7H7ClMg |
| Molecular Weight | 150.88800 |
| Flash Point | 1 °F |
| Exact Mass | 150.00900 |
| LogP | 2.69180 |
| InChIKey | SCEZYJKGDJPHQO-UHFFFAOYSA-M |
| SMILES | [CH2-]c1ccccc1.[Cl-].[Mg+2] |
| Storage condition | water-free area |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H314 |
| Supplemental HS | May form explosive peroxides. |
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
| Hazard Codes | F:Flammable;C:Corrosive; |
| Risk Phrases | R11;R14/15;R19;R34 |
| Safety Phrases | S16-S29-S33-S7/8-S45-S43-S36/37/39-S26-S6A-S43B |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Packaging Group | II |
| Hazard Class | 4.3 |
| HS Code | 2931900090 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 230-039-0 |
| MFCD00000469 |
| magnesium,methanidylbenzene,chloride |