BOC-2-ABZ-OH structure
|
Common Name | BOC-2-ABZ-OH | ||
|---|---|---|---|---|
| CAS Number | 68790-38-5 | Molecular Weight | 237.252 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 328.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | 153-156ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 152.5±23.2 °C | |
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.6±25.0 °C at 760 mmHg |
| Melting Point | 153-156ºC (dec.) |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.252 |
| Flash Point | 152.5±23.2 °C |
| Exact Mass | 237.100113 |
| PSA | 75.63000 |
| LogP | 3.79 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | BYGHHEDJDSLEKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1C(=O)O |
| Storage condition | Store at 0-5°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Boc-anthranilic acid |
| MFCD00151862 |
| Boc-protected anthranilic acid |
| 2-(Boc-amino)benzoic acid |
| 2-[(tert-Butoxycarbonyl)amino]benzoic acid |
| N-Boc-anthralinic acid |
| 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)benzoic acid |
| Benzoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| QVR BMVOX1&1&1 |
| BOC-2-ABZ-OH |
| 2-[[(1,1-dimethylethoxy)carbonyl]amino]benzoic acid |
| 2-tert-butoxycarbonylaminobenzoic acid |
| 2-(t-butyloxycarbonylamino)-benzoic acid |
| Boc-2-aminobenzoic acid |