ω-Muricholic Acid
Modify Date: 2025-08-23 16:49:25
ω-Muricholic Acid structure
|
Common Name | ω-Muricholic Acid | ||
|---|---|---|---|---|
| CAS Number | 6830-03-1 | Molecular Weight | 408.571 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 565.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C24H40O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.0±23.8 °C | |
Use of ω-Muricholic Acidω-Muricholic acid (ω-MCA) is a murine-specific secondary bile acid[1]. |
| Name | ω-Muricholate |
|---|---|
| Synonym | More Synonyms |
| Description | ω-Muricholic acid (ω-MCA) is a murine-specific secondary bile acid[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite Human Endogenous Metabolite |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 565.7±40.0 °C at 760 mmHg |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.571 |
| Flash Point | 310.0±23.8 °C |
| Exact Mass | 408.287567 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | DKPMWHFRUGMUKF-NTPBNISXSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CCC12C |
| Storage condition | -20°C |
| ω-Muricholic Acid |
| ω-Muricholate |
| ω-Muricholic acid |
| Cholan-24-oic acid, 3,6,7-trihydroxy-, (3α,5β,6α,7β)- |
| (3a,5b,6a,7b)-3,6,7-trihydroxy-Cholan-24-oic acid |
| (3α,5β,6α,7β)-3,6,7-Trihydroxycholan-24-oic acid |