Isosulfan blue structure
|
Common Name | Isosulfan blue | ||
|---|---|---|---|---|
| CAS Number | 68238-36-8 | Molecular Weight | 569.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31N2NaO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Isosulfan blueIsosulfan blue is a blue dye for the identification of lymph vessels during lymphangiography. Isosulfan blueis is used during sentinel lymph node biopsies in breast cancer. Isosulfan blue is possible to have an allergic reaction during breast cancer operations[1][2]. |
| Name | sodium,2-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,4-disulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Isosulfan blue is a blue dye for the identification of lymph vessels during lymphangiography. Isosulfan blueis is used during sentinel lymph node biopsies in breast cancer. Isosulfan blue is possible to have an allergic reaction during breast cancer operations[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Isosulfan blue can rapidly uptake into lymph tissue with little diffusion to other surrounding tissues[1]. |
| References |
[2]. Laurie SA, et al. Anaphylaxis to isosulfan blue. Ann Allergy Asthma Immunol. 2002 Jan;88(1):64-6. |
| Molecular Formula | C27H31N2NaO6S2 |
|---|---|
| Molecular Weight | 569.68800 |
| Exact Mass | 569.17600 |
| PSA | 134.58000 |
| LogP | 6.21260 |
| InChIKey | NLUFDZBOHMOBOE-UHFFFAOYSA-M |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2cc(S(=O)(=O)[O-])ccc2S(=O)(=O)[O-])cc1.[Na+] |
| Hazard Codes | Xn |
|---|
| Isosulfan blue [USAN] |
| ISOSULFAN BLUE |
| Disulphin Blau |
| Sulphan Blue |
| Sulphan blue 2,5-disulfophenyl isomer |
| Patentblau V |
| Sulfanblau |
| UNII-39N9K8S2A4 |