N-benzoyl-4-methoxy-benzohydrazide structure
|
Common Name | N-benzoyl-4-methoxy-benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 6781-59-5 | Molecular Weight | 270.28300 | |
| Density | 1.217g/cm3 | Boiling Point | 531ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.9ºC | |
| Name | N'-Benzoyl-4-methoxybenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 531ºC at 760 mmHg |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.28300 |
| Flash Point | 274.9ºC |
| Exact Mass | 270.10000 |
| PSA | 67.43000 |
| LogP | 2.55180 |
| Index of Refraction | 1.591 |
| InChIKey | UNZSJPQQAXWHGN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-benzoyl-2-(4-methoxybenzoyl)hydrazine |
| 1-(4-methoxybenzoyl)-2-benzoylhydrazine |
| N-benzoyl-N'-(4-methoxy-benzoyl)-hydrazine |
| 1-(p-anisoyl)-2-benzoyl hydrazide |
| 2-(4-methoxybenzoyl)benzhydrazide |
| N-Benzoyl-N'-(4-methoxy-benzoyl)-hydrazin |