N-benzoyl-4-methoxy-N-phenylbenzamide
Modify Date: 2025-08-27 00:08:25
N-benzoyl-4-methoxy-N-phenylbenzamide structure
|
Common Name | N-benzoyl-4-methoxy-N-phenylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 61582-62-5 | Molecular Weight | 331.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzoyl-4-methoxy-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H17NO3 |
|---|---|
| Molecular Weight | 331.36500 |
| Exact Mass | 331.12100 |
| PSA | 46.61000 |
| LogP | 4.18240 |
| InChIKey | MWUBXKIIYUPPHN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)N(C(=O)c2ccccc2)c2ccccc2)cc1 |
|
~%
N-benzoyl-4-met... CAS#:61582-62-5 |
| Literature: Wheeler; Johnson American Chemical Journal, 1903 , vol. 30, p. 37 |
|
~%
N-benzoyl-4-met... CAS#:61582-62-5 |
| Literature: Brady, Kieran; Hegarty, Anthony F. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 121 - 126 |
|
~%
N-benzoyl-4-met... CAS#:61582-62-5 |
| Literature: Wheeler; Johnson American Chemical Journal, 1903 , vol. 30, p. 37 |
| Benzamide,N-benzoyl-4-methoxy-N-phenyl |
| 4-methoxy-N-phenyl-dibenzamide |
| Benzoyl-anisoyl-anilin |
| N-Anisoyl-benzanilid |
| N-p-Anisoyl-N-benzoyl-anilin |