6-((4-(Aminomethyl)benzyl)oxy)-7H-purin-2-amine structure
|
Common Name | 6-((4-(Aminomethyl)benzyl)oxy)-7H-purin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 674799-96-3 | Molecular Weight | 270.290 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 669.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C13H14N6O | Melting Point | >240°C | |
| MSDS | N/A | Flash Point | 359.0±34.3 °C | |
| Name | 6-((4-(Aminomethyl)benzyl)oxy)-7H-purin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 669.9±65.0 °C at 760 mmHg |
| Melting Point | >240°C |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.290 |
| Flash Point | 359.0±34.3 °C |
| Exact Mass | 270.122894 |
| PSA | 115.73000 |
| LogP | 0.82 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.748 |
| InChIKey | UINSGVKWAFJDPI-UHFFFAOYSA-N |
| SMILES | NCc1ccc(COc2nc(N)nc3nc[nH]c23)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[[4-(Aminomethyl)phenyl]methoxy]-7H-purin-2-amine |
| O6-(4-aminomethyl)benzylguanine |
| 7H-Purin-2-amine, 6-[[4-(aminomethyl)phenyl]methoxy]- |
| 6-[[4-(AMinoMethyl)phenyl]Methoxy]-1H-purin-2-aMine |
| 6-{[4-(Aminomethyl)benzyl]oxy}-3H-purin-2-amine |