Isorhamnetin 3-O-galactoside structure
|
Common Name | Isorhamnetin 3-O-galactoside | ||
|---|---|---|---|---|
| CAS Number | 6743-92-6 | Molecular Weight | 478.403 | |
| Density | 1.75±0.1 g/cm3 | Boiling Point | 834.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H22O12 | Melting Point | 267-269 ºC | |
| MSDS | N/A | Flash Point | 291.3±27.8 °C | |
Use of Isorhamnetin 3-O-galactosideIsorhamnetin 3-O-galactoside (Cacticin), a flavonoid glycoside isolated from Artemisia capillaris Thunberg, which ameliorates CCl4-induced hepatic damage by enhancing the anti-oxidative defense system and reducing the inflammatory signaling pathways. Isorhamnetin 3-O-galactoside (Cacticin) has antithrombotic and anti-inflammatory activities[1][2][3]. |
| Name | Isorhamnetin 3-O-galactoside |
|---|---|
| Synonym | More Synonyms |
| Description | Isorhamnetin 3-O-galactoside (Cacticin), a flavonoid glycoside isolated from Artemisia capillaris Thunberg, which ameliorates CCl4-induced hepatic damage by enhancing the anti-oxidative defense system and reducing the inflammatory signaling pathways. Isorhamnetin 3-O-galactoside (Cacticin) has antithrombotic and anti-inflammatory activities[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.75±0.1 g/cm3 |
|---|---|
| Boiling Point | 834.4±65.0 °C at 760 mmHg |
| Melting Point | 267-269 ºC |
| Molecular Formula | C22H22O12 |
| Molecular Weight | 478.403 |
| Flash Point | 291.3±27.8 °C |
| Exact Mass | 478.111115 |
| PSA | 199.51000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.750 |
| InChIKey | CQLRUIIRRZYHHS-HEQLHBKPSA-N |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC2OC(CO)C(O)C(O)C2O)ccc1O |
| Water Solubility | Very slightly soluble (0.34 g/L) (25 ºC) |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 3-(β-D-galactopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)- |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl β-D-galactopyranoside |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl b-D-glucopyranoside |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl-β-D-glucopyranoside |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-4H-chromen-3-yl β-D-glucopyranoside |
| isorhamnetin 3-glucoside |
| Isorhamnetin-3-O-glucoside |
| 4H-1-Benzopyran-4-one, 3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)- |
| 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}-4H-chromen-4-on |
| Isorhamnetin-3-O-β-D-glucopyranoside |
| isohamnetin-3-O-β-glucoside |
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3-[(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| 5,7-Dihydroxy-2-(4-hydroxy-3-méthoxyphényl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxyméthyl)tétrahydro-2H-pyran-2-yl]oxy}-4H-chromén-4-one |
| ISORHAMNETIN-3-GLUCOSIDE |