4H-1-Benzopyran-4-one,2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy- structure
|
Common Name | 4H-1-Benzopyran-4-one,2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 1244-78-6 | Molecular Weight | 358.34200 | |
| Density | 1.325g/cm3 | Boiling Point | 550.9ºC at 760mmHg | |
| Molecular Formula | C19H18O7 | Melting Point | 195.6 °C | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | quercetin 5,7,3',4'-tetramethyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 550.9ºC at 760mmHg |
| Melting Point | 195.6 °C |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.34200 |
| Flash Point | 198.3ºC |
| Exact Mass | 358.10500 |
| PSA | 87.36000 |
| LogP | 3.20000 |
| Vapour Pressure | 5.7E-13mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | AAASNKNLMQBKFV-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(=O)c(O)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914509090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxychromen-4-one |
| 3-hydroxy-3',4',5,7-tetramethoxyflavone |
| 5,7,3',4'-tetra-O-methylquercetin |