ETHYL 3,4-DICHLOROPHENYLACETATE structure
|
Common Name | ETHYL 3,4-DICHLOROPHENYLACETATE | ||
|---|---|---|---|---|
| CAS Number | 6725-45-7 | Molecular Weight | 233.09100 | |
| Density | 1.276g/cm3 | Boiling Point | 291ºC at 760 mmHg | |
| Molecular Formula | C10H10Cl2O2 | Melting Point | 24-26ºC | |
| MSDS | N/A | Flash Point | 116.5ºC | |
| Name | ethyl 2-(3,4-dichlorophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 291ºC at 760 mmHg |
| Melting Point | 24-26ºC |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09100 |
| Flash Point | 116.5ºC |
| Exact Mass | 232.00600 |
| PSA | 26.30000 |
| LogP | 3.09900 |
| Index of Refraction | 1.532 |
| InChIKey | QAEBVJIVEPSFRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc(Cl)c(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~87%
ETHYL 3,4-DICHL... CAS#:6725-45-7 |
| Literature: Nippon Kayaku Kabushiki Kaisha Patent: US6433174 B1, 2002 ; |
|
~83%
ETHYL 3,4-DICHL... CAS#:6725-45-7 |
| Literature: Haynes, Nancy-Ellen; Corbett, Wendy L.; Bizzarro, Fred T.; Guertin, Kevin R.; Hilliard, Darryl W.; Holland, George W.; Kester, Robert F.; Mahaney, Paige E.; Qi, Lida; Spence, Cheryl L.; Tengi, John; Dvorozniak, Mark T.; Railkar, Aruna; Matschinsky, Franz M.; Grippo, Joseph F.; Grimsby, Joseph; Sarabu, Ramakanth Journal of Medicinal Chemistry, 2010 , vol. 53, # 9 p. 3618 - 3625 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (3,4-dichloro-phenyl)-acetic acid ethyl ester |
| 3,4-dichlorophenylacetate d'ethyle |
| ethyl (3,4-dichlorophenyl)acetate |
| ethyl (3,4-dichlorobenzene)acetate |
| (3,4-Dichlor-phenyl)-essigsaeure-aethylester |