Platycodin A structure
|
Common Name | Platycodin A | ||
|---|---|---|---|---|
| CAS Number | 66779-34-8 | Molecular Weight | 1267.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C59H94O29 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Platycodin APlatycodin A is monoacetylated saponin compound isolated fromhe roots of Platycodon grandiflorum A. DC.[1]. |
| Name | 2''-O-acetylplatycodin D |
|---|---|
| Synonym | More Synonyms |
| Description | Platycodin A is monoacetylated saponin compound isolated fromhe roots of Platycodon grandiflorum A. DC.[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C59H94O29 |
|---|---|
| Molecular Weight | 1267.36000 |
| Exact Mass | 1266.59000 |
| PSA | 459.35000 |
| InChIKey | CNHZRRBWLMSLDX-WNHLAMKZSA-N |
| SMILES | CC(=O)OC1C(OC2C(OC(=O)C34CCC(C)(C)CC3C3=CCC5C6(C)CC(O)C(OC7OC(CO)C(O)C(O)C7O)C(CO)(CO)C6CCC5(C)C3(C)CC4O)OCC(O)C2O)OC(C)C(OC2OCC(O)C(OC3OCC(O)(CO)C3O)C2O)C1O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2\-O-acetylplatycodin-D |
| 2''-APD |