2-hydrazinyl-3-(4-methoxyphenyl)quinazolin-4-one
Modify Date: 2025-08-22 10:54:41
2-hydrazinyl-3-(4-methoxyphenyl)quinazolin-4-one structure
|
Common Name | 2-hydrazinyl-3-(4-methoxyphenyl)quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 66679-68-3 | Molecular Weight | 282.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydrazinyl-3-(4-methoxyphenyl)quinazolin-4-one |
|---|
| Molecular Formula | C15H14N4O2 |
|---|---|
| Molecular Weight | 282.29700 |
| Exact Mass | 282.11200 |
| PSA | 82.17000 |
| LogP | 2.45320 |
| InChIKey | GTSFZGZLLJHLPA-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(NN)nc3ccccc3c2=O)cc1 |
|
~88%
2-hydrazinyl-3-... CAS#:66679-68-3 |
| Literature: Deshmukh; Patil, Suresh S.; Patil, Sanjeevani S.; Jadhav, Swati D. Journal of Heterocyclic Chemistry, 2010 , vol. 47, # 5 p. 1144 - 1147 |
|
~72%
2-hydrazinyl-3-... CAS#:66679-68-3 |
| Literature: Alagarsamy, Veerachamy; Murugesan, Sankaranarayanan Chemical and Pharmaceutical Bulletin, 2007 , vol. 55, # 1 p. 76 - 80 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |