3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one
Modify Date: 2025-10-07 09:46:00
3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one structure
|
Common Name | 3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1031-88-5 | Molecular Weight | 284.33300 | |
| Density | 1.4g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | 3-(4-methoxyphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.33300 |
| Flash Point | 235.8ºC |
| Exact Mass | 284.06200 |
| PSA | 79.11000 |
| LogP | 3.05690 |
| Vapour Pressure | 7.13E-09mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | FMFXCPZRAWGWGX-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:66679-68-3
CAS#:81262-72-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-N-p-methoxyphenylquinazoline-2-thione-4-one |
| 2-mercapto-3-(4-methoxyphenyl)quinazolin-4(3H)-one |
| 3-(4-methoxyphenyl)-2-sulfanyl-3-hydroquinazolin-4-one |
| 3-(4-methoxyphenyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 3-p-methoxyphenyl-4-oxoquinazoline-2-thione |
| 3-(4-methoxyphenyl)-2-thioxo-2,3-dihydro-1H-quinazolin-4-one |