2-Methoxy-5-nitro-4-icoline structure
|
Common Name | 2-Methoxy-5-nitro-4-icoline | ||
|---|---|---|---|---|
| CAS Number | 6635-90-1 | Molecular Weight | 168.150 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 280.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 123.3±25.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-Methoxy-4-methyl-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 280.3±35.0 °C at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 123.3±25.9 °C |
| Exact Mass | 168.053497 |
| PSA | 67.94000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | DJNQRLCFAHKFLZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c([N+](=O)[O-])cn1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~96%
2-Methoxy-5-nit... CAS#:6635-90-1 |
| Literature: TAKEDA PHARMACEUTICAL COMPANY LIMITED Patent: US2009/186879 A1, 2009 ; Location in patent: Page/Page column 59 ; US 20090186879 A1 |
|
~68%
2-Methoxy-5-nit... CAS#:6635-90-1 |
| Literature: Phenex Pharmaceuticals AG Patent: EP1894924 A1, 2008 ; Location in patent: Page/Page column 33 ; |
|
~%
2-Methoxy-5-nit... CAS#:6635-90-1 |
| Literature: US5366972 A1, ; |
|
~%
2-Methoxy-5-nit... CAS#:6635-90-1 |
| Literature: Journal of the Chemical Society, , p. 2448,2455 |
|
~%
2-Methoxy-5-nit... CAS#:6635-90-1 |
| Literature: Journal of the Chemical Society, , p. 2448,2455 |
|
~%
2-Methoxy-5-nit... CAS#:6635-90-1 |
| Literature: Journal of the Chemical Society, , p. 2448,2455 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2-methoxy-4-methyl-5-nitro- |
| 2-Methoxy-4-methyl-5-nitropyridine |
| 2-Methoxy-5-nitro-4-icoline |
| MFCD03095075 |