L-Leucine,L-threonyl-L-valyl- structure
|
Common Name | L-Leucine,L-threonyl-L-valyl- | ||
|---|---|---|---|---|
| CAS Number | 66317-22-4 | Molecular Weight | 331.40800 | |
| Density | 1.158g/cm3 | Boiling Point | 644.3ºC at 760mmHg | |
| Molecular Formula | C15H29N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.5ºC | |
Use of L-Leucine,L-threonyl-L-valyl-Thr-Val-Leu is a central nervous system tripeptide[1]. |
| Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]amino]-4-methylpentanoic acid |
|---|
| Description | Thr-Val-Leu is a central nervous system tripeptide[1]. |
|---|---|
| Related Catalog |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 644.3ºC at 760mmHg |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.40800 |
| Flash Point | 343.5ºC |
| Exact Mass | 331.21100 |
| PSA | 141.75000 |
| LogP | 0.93290 |
| Index of Refraction | 1.507 |
| InChIKey | BKVICMPZWRNWOC-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(N)C(C)O)C(C)C)C(=O)O |