4-Methylumbelliferyl Decanoate
Modify Date: 2025-08-20 09:44:32
4-Methylumbelliferyl Decanoate structure
|
Common Name | 4-Methylumbelliferyl Decanoate | ||
|---|---|---|---|---|
| CAS Number | 66185-70-4 | Molecular Weight | 330.41800 | |
| Density | 1.084g/cm3 | Boiling Point | 465.2ºC at 760 mmHg | |
| Molecular Formula | C20H26O4 | Melting Point | 40-41ºC | |
| MSDS | N/A | Flash Point | 230.2ºC | |
Use of 4-Methylumbelliferyl Decanoate4-Methyl-2-oxo-2H-1-benzopyran-7-yl decanoate is a fluorogenic substrate used to follow the hydrolytic activity of carboxylesterases[1]. |
| Name | (4-methyl-2-oxochromen-7-yl) decanoate |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Methyl-2-oxo-2H-1-benzopyran-7-yl decanoate is a fluorogenic substrate used to follow the hydrolytic activity of carboxylesterases[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Matthias Joseph KNAPE,et al. Method for detecting contaminating lipase activity. WO2022049294A1. |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 465.2ºC at 760 mmHg |
| Melting Point | 40-41ºC |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.41800 |
| Flash Point | 230.2ºC |
| Exact Mass | 330.18300 |
| PSA | 56.51000 |
| LogP | 5.14750 |
| Index of Refraction | 1.521 |
| InChIKey | HTFJJKMPGKQQNM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Oc1ccc2c(C)cc(=O)oc2c1 |
| Decanoic Acid 4-Methyl-2-oxo-2H-1-benzopyran-7-yl Ester |
| 4-Methylumbelliferyl Decanoate |